C21H32N2O — CID 69119012
(3aS,7aR)-4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 69119012) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (3aS,7aR)-4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | (3aS,7aR)-4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 69119012 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (3aS,7aR)-4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | CC1CCCN1CCc1ccc(C2(O)CCC[C@H]3CNC[C@H]32)cc1 |
| InChI | InChI=1S/C21H32N2O/c1-16-4-3-12-23(16)13-10-17-6-8-19(9-7-17)21(24)11-2-5-18-14-22-15-20(18)21/h6-9,16,18,20,22,24H,2-5,10-15H2,1H3/t16?,18-,20+,21?/m0/s1 |
| InChIKey | MQYDKVQXLFZNON-ONCWYMQZSA-N |
| XLogP | 2.92 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |