C21H26N2O2S — CID 24886607
(2R)-1-[2-[4-[4-(aziridin-1-ylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine (PubChem CID 24886607) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (2R)-1-[2-[4-[4-(aziridin-1-ylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine.
| Compound Name | (2R)-1-[2-[4-[4-(aziridin-1-ylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 24886607 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2R)-1-[2-[4-[4-(aziridin-1-ylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
| SMILES | C[C@@H]1CCCN1CCc1ccc(-c2ccc(S(=O)(=O)N3CC3)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-17-3-2-13-22(17)14-12-18-4-6-19(7-5-18)20-8-10-21(11-9-20)26(24,25)23-15-16-23/h4-11,17H,2-3,12-16H2,1H3/t17-/m1/s1 |
| InChIKey | NRRFNKOLUDFTRI-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|