C21H27NO3S — CID 67218599
1-[2-[4-[4-(methoxymethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine (PubChem CID 67218599) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[2-[4-[4-(methoxymethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine.
| Compound Name | 1-[2-[4-[4-(methoxymethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 67218599 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[2-[4-[4-(methoxymethylsulfonyl)phenyl]phenyl]ethyl]-2-methylpyrrolidine |
| SMILES | COCS(=O)(=O)c1ccc(-c2ccc(CCN3CCCC3C)cc2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-17-4-3-14-22(17)15-13-18-5-7-19(8-6-18)20-9-11-21(12-10-20)26(23,24)16-25-2/h5-12,17H,3-4,13-16H2,1-2H3 |
| InChIKey | BPPADGBWXFDIBT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |