C10H17FO — CID 134933667
[(1S,2R)-2-cyclohexyl-1-fluorocyclopropyl]methanol (PubChem CID 134933667) has the molecular formula C10H17FO and a molecular weight of 172.24 g/mol. Its IUPAC name is [(1S,2R)-2-cyclohexyl-1-fluorocyclopropyl]methanol.
| Compound Name | [(1S,2R)-2-cyclohexyl-1-fluorocyclopropyl]methanol |
|---|---|
| PubChem CID | 134933667 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | [(1S,2R)-2-cyclohexyl-1-fluorocyclopropyl]methanol |
| SMILES | OC[C@]1(F)C[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C10H17FO/c11-10(7-12)6-9(10)8-4-2-1-3-5-8/h8-9,12H,1-7H2/t9-,10-/m1/s1 |
| InChIKey | UAHNYKGMFJFEBH-NXEZZACHSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |