About 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid
2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid (PubChem CID 10036063) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid |
| PubChem CID | 10036063 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid |
| SMILES | NC[C@@]1(CC(=O)O)C[C@@H]2CCCCC[C@@H]21 |
| InChI | InChI=1S/C12H21NO2/c13-8-12(7-11(14)15)6-9-4-2-1-3-5-10(9)12/h9-10H,1-8,13H2,(H,14,15)/t9-,10-,12-/m0/s1 |
| InChIKey | CBDIXAZIJVPJBK-NHCYSSNCSA-N |
| XLogP | 2.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid?
The IUPAC name of 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid (CID 10036063) is 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid.
What is the SMILES notation for 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid?
The canonical SMILES for 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid is NC[C@@]1(CC(=O)O)C[C@@H]2CCCCC[C@@H]21.
What is the InChIKey of 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid?
The InChIKey is CBDIXAZIJVPJBK-NHCYSSNCSA-N. The full InChI is InChI=1S/C12H21NO2/c13-8-12(7-11(14)15)6-9-4-2-1-3-5-10(9)12/h9-10H,1-8,13H2,(H,14,15)/t9-,10-,12-/m0/s1.
What are the key properties of 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid?
2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid has a molecular weight of 211.30 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,7S,8R)-8-(aminomethyl)-8-bicyclo[5.2.0]nonanyl]acetic acid is sourced from PubChem (CID 10036063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).