C16H29NO2 — CID 145337620
2-[(6R)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;ethylcyclobutane (PubChem CID 145337620) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-[(6R)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;ethylcyclobutane.
| Compound Name | 2-[(6R)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;ethylcyclobutane |
|---|---|
| PubChem CID | 145337620 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-[(6R)-6-(aminomethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid;ethylcyclobutane |
| SMILES | CCC1CCC1.NC[C@@]1(CC(=O)O)CC2CCCC21 |
| InChI | InChI=1S/C10H17NO2.C6H12/c11-6-10(5-9(12)13)4-7-2-1-3-8(7)10;1-2-6-4-3-5-6/h7-8H,1-6,11H2,(H,12,13);6H,2-5H2,1H3/t7?,8?,10-;/m0./s1 |
| InChIKey | DUISJYHRBNZNKF-NOXKLTGNSA-N |
| XLogP | 3.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |