C12H23N — CID 149036718
[(1R,7R,8S)-8-ethyl-8-bicyclo[5.2.0]nonanyl]methanamine (PubChem CID 149036718) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is [(1R,7R,8S)-8-ethyl-8-bicyclo[5.2.0]nonanyl]methanamine.
| Compound Name | [(1R,7R,8S)-8-ethyl-8-bicyclo[5.2.0]nonanyl]methanamine |
|---|---|
| PubChem CID | 149036718 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | [(1R,7R,8S)-8-ethyl-8-bicyclo[5.2.0]nonanyl]methanamine |
| SMILES | CC[C@]1(CN)C[C@H]2CCCCC[C@H]21 |
| InChI | InChI=1S/C12H23N/c1-2-12(9-13)8-10-6-4-3-5-7-11(10)12/h10-11H,2-9,13H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | QGTQKPVRHMCGQA-IJLUTSLNSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |