2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid

C9H15NO2 — CID 178190998

IUPAC2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid
SMILESNC1(CC(=O)O)C[C@H]2CCC[C@H]21
InChIInChI=1S/C9H15NO2/c10-9(5-8(11)12)4-6-2-1-3-7(6)9/h6-7H,1-5,10H2,(H,11,12)/t6-,7-,9?/m1/s1
InChIKeyMNAYHIXOKDYXDB-UMPGHQJDSA-N
MW169.22 g/mol
LogP0.98
Rot. Bonds2

About 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid

2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid (PubChem CID 178190998) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid.

Molecular Properties

Compound Name2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid
PubChem CID178190998
Molecular FormulaC9H15NO2
Molecular Weight169.22 g/mol
Exact Mass169.11
IUPAC Name2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid
SMILESNC1(CC(=O)O)C[C@H]2CCC[C@H]21
InChIInChI=1S/C9H15NO2/c10-9(5-8(11)12)4-6-2-1-3-7(6)9/h6-7H,1-5,10H2,(H,11,12)/t6-,7-,9?/m1/s1
InChIKeyMNAYHIXOKDYXDB-UMPGHQJDSA-N
XLogP0.98
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.22
LogP ≤ 50.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid?
The IUPAC name of 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid (CID 178190998) is 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid.
What is the SMILES notation for 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid?
The canonical SMILES for 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid is NC1(CC(=O)O)C[C@H]2CCC[C@H]21.
What is the InChIKey of 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid?
The InChIKey is MNAYHIXOKDYXDB-UMPGHQJDSA-N. The full InChI is InChI=1S/C9H15NO2/c10-9(5-8(11)12)4-6-2-1-3-7(6)9/h6-7H,1-5,10H2,(H,11,12)/t6-,7-,9?/m1/s1.
What are the key properties of 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid?
2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid has a molecular weight of 169.22 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetic acid is sourced from PubChem (CID 178190998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).