C10H17NO2 — CID 178191667
methyl 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetate (PubChem CID 178191667) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetate.
| Compound Name | methyl 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetate |
|---|---|
| PubChem CID | 178191667 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | methyl 2-[(1R,5R)-6-amino-6-bicyclo[3.2.0]heptanyl]acetate |
| SMILES | COC(=O)CC1(N)C[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C10H17NO2/c1-13-9(12)6-10(11)5-7-3-2-4-8(7)10/h7-8H,2-6,11H2,1H3/t7-,8-,10?/m1/s1 |
| InChIKey | ZHHUASHEHPRWBW-SZBHIRRCSA-N |
| XLogP | 1.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |