C12H22O — CID 22164638
(3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl)methanol (PubChem CID 22164638) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl)methanol.
| Compound Name | (3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl)methanol |
|---|---|
| PubChem CID | 22164638 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (3,3-dimethyl-1,2,3a,4,5,6,7,7a-octahydroinden-1-yl)methanol |
| SMILES | CC1(C)CC(CO)C2CCCCC21 |
| InChI | InChI=1S/C12H22O/c1-12(2)7-9(8-13)10-5-3-4-6-11(10)12/h9-11,13H,3-8H2,1-2H3 |
| InChIKey | JRXPMSWIZIYRME-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |