C38H60O36P4 — CID 18394285
[(1S,2R,3S,4S,5R,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-butanoyloxycyclohexyl] butanoate (PubChem CID 18394285) has the molecular formula C38H60O36P4 and a molecular weight of 1216.76 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-butanoyloxycyclohexyl] butanoate.
| Compound Name | [(1S,2R,3S,4S,5R,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-butanoyloxycyclohexyl] butanoate |
|---|---|
| PubChem CID | 18394285 |
| Molecular Formula | C38H60O36P4 |
| Molecular Weight | 1216.76 g/mol |
| Exact Mass | 1216.18 |
| IUPAC Name | [(1S,2R,3S,4S,5R,6S)-2,3,4,5-tetrakis[bis(acetyloxymethoxy)phosphoryloxy]-6-butanoyloxycyclohexyl] butanoate |
| SMILES | CCCC(=O)O[C@H]1[C@H](OC(=O)CCC)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H]1OP(=O)(OCOC(C)=O)OCOC(C)=O |
| InChI | InChI=1S/C38H60O36P4/c1-11-13-31(47)69-33-34(70-32(48)14-12-2)36(72-76(50,63-17-55-25(5)41)64-18-56-26(6)42)38(74-78(52,67-21-59-29(9)45)68-22-60-30(10)46)37(73-77(51,65-19-57-27(7)43)66-20-58-28(8)44)35(33)71-75(49,61-15-53-23(3)39)62-16-54-24(4)40/h33-38H,11-22H2,1-10H3/t33-,34-,35+,36+,37-,38-/m0/s1 |
| InChIKey | PHGLLOSSJCMJOH-MXAQTWTRSA-N |
| XLogP | 3.69 |
| TPSA | 442.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 36 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1216.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 36 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|