C13H29O22P5 — CID 154133865
(2,3,4,5,6-pentaphosphonooxy-3-propylcyclohexyl) butanoate (PubChem CID 154133865) has the molecular formula C13H29O22P5 and a molecular weight of 692.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentaphosphonooxy-3-propylcyclohexyl) butanoate.
| Compound Name | (2,3,4,5,6-pentaphosphonooxy-3-propylcyclohexyl) butanoate |
|---|---|
| PubChem CID | 154133865 |
| Molecular Formula | C13H29O22P5 |
| Molecular Weight | 692.22 g/mol |
| Exact Mass | 691.98 |
| IUPAC Name | (2,3,4,5,6-pentaphosphonooxy-3-propylcyclohexyl) butanoate |
| SMILES | CCCC(=O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(CCC)(OP(=O)(O)O)C1OP(=O)(O)O |
| InChI | InChI=1S/C13H29O22P5/c1-3-5-7(14)30-9-8(31-36(15,16)17)10(32-37(18,19)20)12(34-39(24,25)26)13(6-4-2,35-40(27,28)29)11(9)33-38(21,22)23/h8-12H,3-6H2,1-2H3,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)(H2,27,28,29) |
| InChIKey | IASARDFFCINBLQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 360.10 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|