C37H56O18 — CID 14840242
[4,5-diacetyloxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-undec-10-enoxyoxan-2-yl]methyl acetate (PubChem CID 14840242) has the molecular formula C37H56O18 and a molecular weight of 788.84 g/mol. Its IUPAC name is [4,5-diacetyloxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-undec-10-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-undec-10-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14840242 |
| Molecular Formula | C37H56O18 |
| Molecular Weight | 788.84 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | [4,5-diacetyloxy-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-undec-10-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCCCCCCCCCOC1OC(COC(C)=O)C(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C37H56O18/c1-9-10-11-12-13-14-15-16-17-18-45-36-34(51-26(7)43)33(50-25(6)42)31(29(53-36)20-47-22(3)39)55-37-35(52-27(8)44)32(49-24(5)41)30(48-23(4)40)28(54-37)19-46-21(2)38/h9,28-37H,1,10-20H2,2-8H3 |
| InChIKey | CPBVLAXHEVVSPK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 221.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|