C21H28O8 — CID 144528432
(E)-8-[(3S,5R)-3-hydroxy-5-(4-hydroxybenzoyl)oxy-6-methyloxan-2-yl]oxyoct-2-enoic acid (PubChem CID 144528432) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is (E)-8-[(3S,5R)-3-hydroxy-5-(4-hydroxybenzoyl)oxy-6-methyloxan-2-yl]oxyoct-2-enoic acid.
| Compound Name | (E)-8-[(3S,5R)-3-hydroxy-5-(4-hydroxybenzoyl)oxy-6-methyloxan-2-yl]oxyoct-2-enoic acid |
|---|---|
| PubChem CID | 144528432 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (E)-8-[(3S,5R)-3-hydroxy-5-(4-hydroxybenzoyl)oxy-6-methyloxan-2-yl]oxyoct-2-enoic acid |
| SMILES | CC1OC(OCCCCC/C=C/C(=O)O)[C@@H](O)C[C@H]1OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H28O8/c1-14-18(29-20(26)15-8-10-16(22)11-9-15)13-17(23)21(28-14)27-12-6-4-2-3-5-7-19(24)25/h5,7-11,14,17-18,21-23H,2-4,6,12-13H2,1H3,(H,24,25)/b7-5+/t14?,17-,18+,21?/m0/s1 |
| InChIKey | QZKCIFUNSQBGPM-CMZGUSNRSA-N |
| XLogP | 2.63 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|