C23H29NO7 — CID 163442100
(E)-8-[(2R,5R)-3-hydroxy-5-(1H-indole-3-carbonyloxy)-6-methyloxan-2-yl]oxyoct-2-enoic acid (PubChem CID 163442100) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is (E)-8-[(2R,5R)-3-hydroxy-5-(1H-indole-3-carbonyloxy)-6-methyloxan-2-yl]oxyoct-2-enoic acid.
| Compound Name | (E)-8-[(2R,5R)-3-hydroxy-5-(1H-indole-3-carbonyloxy)-6-methyloxan-2-yl]oxyoct-2-enoic acid |
|---|---|
| PubChem CID | 163442100 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (E)-8-[(2R,5R)-3-hydroxy-5-(1H-indole-3-carbonyloxy)-6-methyloxan-2-yl]oxyoct-2-enoic acid |
| SMILES | CC1O[C@@H](OCCCCC/C=C/C(=O)O)C(O)C[C@H]1OC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H29NO7/c1-15-20(31-22(28)17-14-24-18-10-7-6-9-16(17)18)13-19(25)23(30-15)29-12-8-4-2-3-5-11-21(26)27/h5-7,9-11,14-15,19-20,23-25H,2-4,8,12-13H2,1H3,(H,26,27)/b11-5+/t15?,19?,20-,23-/m1/s1 |
| InChIKey | AZKAYEKCXPLQKN-OZPCDKPBSA-N |
| XLogP | 3.41 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|