C18H20N2O2 — CID 25050290
1-azatricyclo[3.3.1.13,7]decan-4-yl 1H-indole-3-carboxylate (PubChem CID 25050290) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decan-4-yl 1H-indole-3-carboxylate.
| Compound Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 25050290 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decan-4-yl 1H-indole-3-carboxylate |
| SMILES | O=C(OC1C2CC3CC1CN(C3)C2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20N2O2/c21-18(15-7-19-16-4-2-1-3-14(15)16)22-17-12-5-11-6-13(17)10-20(8-11)9-12/h1-4,7,11-13,17,19H,5-6,8-10H2 |
| InChIKey | KRDTWOFRGVMETR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |