C17H18N2O2 — CID 15132444
(2-methylidene-1-azabicyclo[2.2.2]octan-3-yl) 1H-indole-3-carboxylate (PubChem CID 15132444) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2-methylidene-1-azabicyclo[2.2.2]octan-3-yl) 1H-indole-3-carboxylate.
| Compound Name | (2-methylidene-1-azabicyclo[2.2.2]octan-3-yl) 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 15132444 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2-methylidene-1-azabicyclo[2.2.2]octan-3-yl) 1H-indole-3-carboxylate |
| SMILES | C=C1C(OC(=O)c2c[nH]c3ccccc23)C2CCN1CC2 |
| InChI | InChI=1S/C17H18N2O2/c1-11-16(12-6-8-19(11)9-7-12)21-17(20)14-10-18-15-5-3-2-4-13(14)15/h2-5,10,12,16,18H,1,6-9H2 |
| InChIKey | GSNOASNQIWYLQL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |