C18H24N2O2 — CID 54474545
1-(4-methylpiperidin-1-yl)propan-2-yl 1H-indole-3-carboxylate (PubChem CID 54474545) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)propan-2-yl 1H-indole-3-carboxylate.
| Compound Name | 1-(4-methylpiperidin-1-yl)propan-2-yl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 54474545 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)propan-2-yl 1H-indole-3-carboxylate |
| SMILES | CC1CCN(CC(C)OC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-13-7-9-20(10-8-13)12-14(2)22-18(21)16-11-19-17-6-4-3-5-15(16)17/h3-6,11,13-14,19H,7-10,12H2,1-2H3 |
| InChIKey | XKPXDPMHDBGIOQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |