C17H22N2O2 — CID 54523063
(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate (PubChem CID 54523063) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate.
| Compound Name | (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 54523063 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate |
| SMILES | CC1CCCC(COC(=O)c2c[nH]c3ccccc23)N1C |
| InChI | InChI=1S/C17H22N2O2/c1-12-6-5-7-13(19(12)2)11-21-17(20)15-10-18-16-9-4-3-8-14(15)16/h3-4,8-10,12-13,18H,5-7,11H2,1-2H3 |
| InChIKey | YRFBCEIDJICPJP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |