(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate

C17H22N2O2 — CID 54523063

IUPAC(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate
SMILESCC1CCCC(COC(=O)c2c[nH]c3ccccc23)N1C
InChIInChI=1S/C17H22N2O2/c1-12-6-5-7-13(19(12)2)11-21-17(20)15-10-18-16-9-4-3-8-14(15)16/h3-4,8-10,12-13,18H,5-7,11H2,1-2H3
InChIKeyYRFBCEIDJICPJP-UHFFFAOYSA-N
MW286.37 g/mol
LogP3.20
Rot. Bonds3

About (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate

(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate (PubChem CID 54523063) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate.

Molecular Properties

Compound Name(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate
PubChem CID54523063
Molecular FormulaC17H22N2O2
Molecular Weight286.37 g/mol
Exact Mass286.17
IUPAC Name(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate
SMILESCC1CCCC(COC(=O)c2c[nH]c3ccccc23)N1C
InChIInChI=1S/C17H22N2O2/c1-12-6-5-7-13(19(12)2)11-21-17(20)15-10-18-16-9-4-3-8-14(15)16/h3-4,8-10,12-13,18H,5-7,11H2,1-2H3
InChIKeyYRFBCEIDJICPJP-UHFFFAOYSA-N
XLogP3.20
TPSA45.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.37
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate?
The IUPAC name of (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate (CID 54523063) is (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate.
What is the SMILES notation for (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate?
The canonical SMILES for (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate is CC1CCCC(COC(=O)c2c[nH]c3ccccc23)N1C.
What is the InChIKey of (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate?
The InChIKey is YRFBCEIDJICPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-12-6-5-7-13(19(12)2)11-21-17(20)15-10-18-16-9-4-3-8-14(15)16/h3-4,8-10,12-13,18H,5-7,11H2,1-2H3.
What are the key properties of (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate?
(1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate has a molecular weight of 286.37 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6-dimethylpiperidin-2-yl)methyl 1H-indole-3-carboxylate is sourced from PubChem (CID 54523063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).