C23H27N3O4S — CID 138403145
[1-[2-(benzenesulfonamido)ethyl]piperidin-4-yl]methyl 1H-indole-3-carboxylate (PubChem CID 138403145) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is [1-[2-(benzenesulfonamido)ethyl]piperidin-4-yl]methyl 1H-indole-3-carboxylate.
| Compound Name | [1-[2-(benzenesulfonamido)ethyl]piperidin-4-yl]methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 138403145 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [1-[2-(benzenesulfonamido)ethyl]piperidin-4-yl]methyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCC1CCN(CCNS(=O)(=O)c2ccccc2)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H27N3O4S/c27-23(21-16-24-22-9-5-4-8-20(21)22)30-17-18-10-13-26(14-11-18)15-12-25-31(28,29)19-6-2-1-3-7-19/h1-9,16,18,24-25H,10-15,17H2 |
| InChIKey | IAUOQYCDFSEWNE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |