C17H25Cl2N3O — CID 21394682
4-(4-aminopiperidin-1-yl)-1-(1H-indol-3-yl)butan-1-one;dihydrochloride (PubChem CID 21394682) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)-1-(1H-indol-3-yl)butan-1-one;dihydrochloride.
| Compound Name | 4-(4-aminopiperidin-1-yl)-1-(1H-indol-3-yl)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 21394682 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)-1-(1H-indol-3-yl)butan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CCCC(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C17H23N3O.2ClH/c18-13-7-10-20(11-8-13)9-3-6-17(21)15-12-19-16-5-2-1-4-14(15)16;;/h1-2,4-5,12-13,19H,3,6-11,18H2;2*1H |
| InChIKey | FOSZOPWUKWSRRD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |