C15H20N2O5S — CID 163123264
[(3S,3aS,6S,6aS)-3-[(2-thiophen-2-ylacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate (PubChem CID 163123264) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(2-thiophen-2-ylacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(2-thiophen-2-ylacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 163123264 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(2-thiophen-2-ylacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H20N2O5S/c1-2-16-15(19)22-11-8-21-13-10(7-20-14(11)13)17-12(18)6-9-4-3-5-23-9/h3-5,10-11,13-14H,2,6-8H2,1H3,(H,16,19)(H,17,18)/t10-,11-,13-,14+/m0/s1 |
| InChIKey | CHDYJNPJOZYPKJ-AUZPSNTRSA-N |
| XLogP | 0.69 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |