C26H29N5O4 — CID 74700504
[3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate (PubChem CID 74700504) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is [3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate.
| Compound Name | [3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 74700504 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC1COC2C1OCC2n1nnnc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N5O4/c32-26(27-20-9-5-2-6-10-20)35-22-16-34-23-21(15-33-24(22)23)31-25(28-29-30-31)19-13-11-18(12-14-19)17-7-3-1-4-8-17/h1,3-4,7-8,11-14,20-24H,2,5-6,9-10,15-16H2,(H,27,32) |
| InChIKey | DQRNBBGJBAACAP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |