C29H27N5O6 — CID 11886071
ethyl 3-[[(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate (PubChem CID 11886071) has the molecular formula C29H27N5O6 and a molecular weight of 541.56 g/mol. Its IUPAC name is ethyl 3-[[(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate.
| Compound Name | ethyl 3-[[(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 11886071 |
| Molecular Formula | C29H27N5O6 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | ethyl 3-[[(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2nnnc2-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H27N5O6/c1-2-37-28(35)21-9-6-10-22(15-21)30-29(36)40-24-17-39-25-23(16-38-26(24)25)34-27(31-32-33-34)20-13-11-19(12-14-20)18-7-4-3-5-8-18/h3-15,23-26H,2,16-17H2,1H3,(H,30,36)/t23-,24+,25+,26+/m0/s1 |
| InChIKey | ZDELIYCITPGHQR-BKKFENPESA-N |
| XLogP | 4.14 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |