C24H21F3N4O4 — CID 73139843
[3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 73139843) has the molecular formula C24H21F3N4O4 and a molecular weight of 486.45 g/mol. Its IUPAC name is [3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 73139843 |
| Molecular Formula | C24H21F3N4O4 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)OC1COC2C(Nc3nccc(-c4ccccc4)n3)COC12 |
| InChI | InChI=1S/C24H21F3N4O4/c25-24(26,27)15-7-4-8-16(11-15)29-23(32)35-19-13-34-20-18(12-33-21(19)20)31-22-28-10-9-17(30-22)14-5-2-1-3-6-14/h1-11,18-21H,12-13H2,(H,29,32)(H,28,30,31) |
| InChIKey | YOKKCZHRYTYMQW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |