C29H35N5O4 — CID 11911818
[(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate (PubChem CID 11911818) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 11911818 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate |
| SMILES | CN(C)c1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@@H]3OC[C@H]4OC(=O)Nc3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C29H35N5O4/c1-29(2,3)19-8-10-20(11-9-19)31-28(35)38-24-17-37-25-23(16-36-26(24)25)33-27-30-15-14-22(32-27)18-6-12-21(13-7-18)34(4)5/h6-15,23-26H,16-17H2,1-5H3,(H,31,35)(H,30,32,33)/t23-,24+,25+,26+/m0/s1 |
| InChIKey | DOVNQOGHXLJQFP-BKKFENPESA-N |
| XLogP | 4.70 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |