C27H29N5O6 — CID 11911800
methyl 2-[[(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate (PubChem CID 11911800) has the molecular formula C27H29N5O6 and a molecular weight of 519.56 g/mol. Its IUPAC name is methyl 2-[[(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate.
| Compound Name | methyl 2-[[(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 11911800 |
| Molecular Formula | C27H29N5O6 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | methyl 2-[[(3S,3aR,6R,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxycarbonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2Nc1nccc(-c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C27H29N5O6/c1-32(2)17-10-8-16(9-11-17)19-12-13-28-26(29-19)30-21-14-36-24-22(15-37-23(21)24)38-27(34)31-20-7-5-4-6-18(20)25(33)35-3/h4-13,21-24H,14-15H2,1-3H3,(H,31,34)(H,28,29,30)/t21-,22+,23+,24+/m0/s1 |
| InChIKey | QMJSDSJWBDQWAT-OLKYXYMISA-N |
| XLogP | 3.19 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |