C29H26N2O7S — CID 11884043
[(3S,3aR,6R,6aS)-3-(naphthalen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate (PubChem CID 11884043) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-(naphthalen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-(naphthalen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11884043 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-(naphthalen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H26N2O7S/c32-29(30-21-11-13-23(14-12-21)37-22-8-2-1-3-9-22)38-26-18-36-27-25(17-35-28(26)27)31-39(33,34)24-15-10-19-6-4-5-7-20(19)16-24/h1-16,25-28,31H,17-18H2,(H,30,32)/t25-,26+,27+,28+/m0/s1 |
| InChIKey | CIMFCIKNSTWJKN-KUXCXQDQSA-N |
| XLogP | 4.69 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |