C14H17N4O7S- — CID 11886722
2-[2-[[(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]sulfanylacetate (PubChem CID 11886722) has the molecular formula C14H17N4O7S- and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[2-[[(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]sulfanylacetate.
| Compound Name | 2-[2-[[(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 11886722 |
| Molecular Formula | C14H17N4O7S- |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[2-[[(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]sulfanylacetate |
| SMILES | COC(=O)c1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)CSCC(=O)[O-])nn1 |
| InChI | InChI=1S/C14H18N4O7S/c1-23-14(22)7-2-18(17-16-7)9-4-25-12-8(3-24-13(9)12)15-10(19)5-26-6-11(20)21/h2,8-9,12-13H,3-6H2,1H3,(H,15,19)(H,20,21)/p-1/t8-,9-,12+,13+/m0/s1 |
| InChIKey | DBRKEFJCNYCPEY-RBJBARPLSA-M |
| XLogP | -2.63 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |