C16H18N4O3 — CID 73134960
N-[6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetamide (PubChem CID 73134960) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetamide.
| Compound Name | N-[6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetamide |
|---|---|
| PubChem CID | 73134960 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetamide |
| SMILES | CC(=O)NC1COC2C1OCC2n1cc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C16H18N4O3/c1-10(21)17-13-8-22-16-14(9-23-15(13)16)20-7-12(18-19-20)11-5-3-2-4-6-11/h2-7,13-16H,8-9H2,1H3,(H,17,21) |
| InChIKey | OWKCABBEFZLLMZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |