C18H20N4O3 — CID 11886725
N-[(3S,3aR,6S,6aR)-6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide (PubChem CID 11886725) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 11886725 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-(4-phenyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1cc(-c2ccccc2)nn1)C1CC1 |
| InChI | InChI=1S/C18H20N4O3/c23-18(12-6-7-12)19-14-9-24-17-15(10-25-16(14)17)22-8-13(20-21-22)11-4-2-1-3-5-11/h1-5,8,12,14-17H,6-7,9-10H2,(H,19,23)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | OAFRRIUKNQOXBX-MWDXBVQZSA-N |
| XLogP | 1.18 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |