C23H31N5O5 — CID 162967091
1-[(3R,3aR,6S,6aS)-3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(3,5-dimethoxyphenyl)urea (PubChem CID 162967091) has the molecular formula C23H31N5O5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[(3R,3aR,6S,6aS)-3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-[(3R,3aR,6S,6aS)-3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 162967091 |
| Molecular Formula | C23H31N5O5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[(3R,3aR,6S,6aS)-3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)N[C@H]2CO[C@H]3[C@H]2OC[C@H]3Nc2nccc(C(C)(C)C)n2)cc(OC)c1 |
| InChI | InChI=1S/C23H31N5O5/c1-23(2,3)18-6-7-24-21(28-18)26-16-11-32-20-17(12-33-19(16)20)27-22(29)25-13-8-14(30-4)10-15(9-13)31-5/h6-10,16-17,19-20H,11-12H2,1-5H3,(H,24,26,28)(H2,25,27,29)/t16-,17+,19-,20+/m1/s1 |
| InChIKey | OQXBFNLETZWQDQ-BWPNAZKDSA-N |
| XLogP | 2.56 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |