C23H32N6O2S — CID 73138674
1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea (PubChem CID 73138674) has the molecular formula C23H32N6O2S and a molecular weight of 456.62 g/mol. Its IUPAC name is 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea.
| Compound Name | 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 73138674 |
| Molecular Formula | C23H32N6O2S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NC2COC3C(Nc4nccc(C(C)(C)C)n4)COC23)cc1 |
| InChI | InChI=1S/C23H32N6O2S/c1-23(2,3)18-10-11-24-21(28-18)26-16-12-30-20-17(13-31-19(16)20)27-22(32)25-14-6-8-15(9-7-14)29(4)5/h6-11,16-17,19-20H,12-13H2,1-5H3,(H,24,26,28)(H2,25,27,32) |
| InChIKey | PHYYHQWUQUBHQN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|