C25H34N6O2S — CID 74699951
1-cyclohexyl-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea (PubChem CID 74699951) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea |
|---|---|
| PubChem CID | 74699951 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 1-cyclohexyl-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea |
| SMILES | CN(C)c1ccc(-c2ccnc(NC3COC4C(NC(=S)NC5CCCCC5)COC34)n2)cc1 |
| InChI | InChI=1S/C25H34N6O2S/c1-31(2)18-10-8-16(9-11-18)19-12-13-26-24(28-19)29-20-14-32-23-21(15-33-22(20)23)30-25(34)27-17-6-4-3-5-7-17/h8-13,17,20-23H,3-7,14-15H2,1-2H3,(H,26,28,29)(H2,27,30,34) |
| InChIKey | HBASCOLXGMBHRJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|