C21H27N5O2S — CID 74693852
1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-phenylthiourea (PubChem CID 74693852) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-phenylthiourea.
| Compound Name | 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 74693852 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[3-[(4-tert-butylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-phenylthiourea |
| SMILES | CC(C)(C)c1ccnc(NC2COC3C(NC(=S)Nc4ccccc4)COC23)n1 |
| InChI | InChI=1S/C21H27N5O2S/c1-21(2,3)16-9-10-22-19(26-16)24-14-11-27-18-15(12-28-17(14)18)25-20(29)23-13-7-5-4-6-8-13/h4-10,14-15,17-18H,11-12H2,1-3H3,(H,22,24,26)(H2,23,25,29) |
| InChIKey | NAIOECFSVCKYEC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|