C16H23N3O3S — CID 73138552
1-[4-(dimethylamino)phenyl]-3-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)thiourea (PubChem CID 73138552) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)thiourea |
|---|---|
| PubChem CID | 73138552 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)thiourea |
| SMILES | COC1COC2C(NC(=S)Nc3ccc(N(C)C)cc3)COC12 |
| InChI | InChI=1S/C16H23N3O3S/c1-19(2)11-6-4-10(5-7-11)17-16(23)18-12-8-21-15-13(20-3)9-22-14(12)15/h4-7,12-15H,8-9H2,1-3H3,(H2,17,18,23) |
| InChIKey | SMOXPXHBWVDBRQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|