C26H31N3O6 — CID 162809653
[(3S,3aS,6S,6aS)-3-[(4-tert-butylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate (PubChem CID 162809653) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(4-tert-butylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(4-tert-butylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 162809653 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(4-tert-butylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
| SMILES | CC(=O)c1cccc(NC(=O)O[C@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NC(=O)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C26H31N3O6/c1-15(30)16-6-5-7-19(12-16)28-25(32)35-21-14-34-22-20(13-33-23(21)22)29-24(31)27-18-10-8-17(9-11-18)26(2,3)4/h5-12,20-23H,13-14H2,1-4H3,(H,28,32)(H2,27,29,31)/t20-,21-,22-,23+/m0/s1 |
| InChIKey | FVJUOZGAKABYAX-CWBXHPNXSA-N |
| XLogP | 4.09 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |