C16H21NO7 — CID 163341407
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2-methylphenoxy)acetamide;formic acid (PubChem CID 163341407) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2-methylphenoxy)acetamide;formic acid.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2-methylphenoxy)acetamide;formic acid |
|---|---|
| PubChem CID | 163341407 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(2-methylphenoxy)acetamide;formic acid |
| SMILES | Cc1ccccc1OCC(=O)N[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O.O=CO |
| InChI | InChI=1S/C15H19NO5.CH2O2/c1-9-4-2-3-5-12(9)19-8-13(18)16-10-6-20-15-11(17)7-21-14(10)15;2-1-3/h2-5,10-11,14-15,17H,6-8H2,1H3,(H,16,18);1H,(H,2,3)/t10-,11-,14-,15-;/m1./s1 |
| InChIKey | PQHGKYPGAZIEFU-FYYMMMFISA-N |
| XLogP | -0.28 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|