C13H16N2O6 — CID 134287699
N-(3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-3,4,5-trihydroxybenzamide (PubChem CID 134287699) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is N-(3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-3,4,5-trihydroxybenzamide.
| Compound Name | N-(3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 134287699 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl)-3,4,5-trihydroxybenzamide |
| SMILES | NC1COC2C(NC(=O)c3cc(O)c(O)c(O)c3)COC12 |
| InChI | InChI=1S/C13H16N2O6/c14-6-3-20-12-7(4-21-11(6)12)15-13(19)5-1-8(16)10(18)9(17)2-5/h1-2,6-7,11-12,16-18H,3-4,14H2,(H,15,19) |
| InChIKey | BJMLFJOMIXSJTG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|