C20H19NO11 — CID 163515681
[6-(3,4,5-trihydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-amino-3,5-dihydroxybenzoate (PubChem CID 163515681) has the molecular formula C20H19NO11 and a molecular weight of 449.37 g/mol. Its IUPAC name is [6-(3,4,5-trihydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-amino-3,5-dihydroxybenzoate.
| Compound Name | [6-(3,4,5-trihydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-amino-3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 163515681 |
| Molecular Formula | C20H19NO11 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [6-(3,4,5-trihydroxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-amino-3,5-dihydroxybenzoate |
| SMILES | Nc1c(O)cc(C(=O)OC2COC3C(OC(=O)c4cc(O)c(O)c(O)c4)COC23)cc1O |
| InChI | InChI=1S/C20H19NO11/c21-15-9(22)1-7(2-10(15)23)19(27)31-13-5-29-18-14(6-30-17(13)18)32-20(28)8-3-11(24)16(26)12(25)4-8/h1-4,13-14,17-18,22-26H,5-6,21H2 |
| InChIKey | DGNAWFWRDLWMDK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|