C27H24O17 — CID 102151025
[(1R,2S,3S,4S,5R)-2,5-dihydroxy-3,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexyl] 3,4,5-trihydroxybenzoate (PubChem CID 102151025) has the molecular formula C27H24O17 and a molecular weight of 620.47 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5R)-2,5-dihydroxy-3,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(1R,2S,3S,4S,5R)-2,5-dihydroxy-3,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 102151025 |
| Molecular Formula | C27H24O17 |
| Molecular Weight | 620.47 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | [(1R,2S,3S,4S,5R)-2,5-dihydroxy-3,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)C[C@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H24O17/c28-11-1-8(2-12(29)19(11)35)25(39)42-18-7-17(34)23(43-26(40)9-3-13(30)20(36)14(31)4-9)24(22(18)38)44-27(41)10-5-15(32)21(37)16(33)6-10/h1-6,17-18,22-24,28-38H,7H2/t17-,18-,22+,23+,24+/m1/s1 |
| InChIKey | UAFWRQZWFGVUSJ-FFCPMTHWSA-N |
| XLogP | 0.14 |
| TPSA | 301.43 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.47 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|