C34H28O21 — CID 11650696
[(2R,3S,4R,6R)-3,4,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 11650696) has the molecular formula C34H28O21 and a molecular weight of 772.58 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-3,4,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4R,6R)-3,4,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 11650696 |
| Molecular Formula | C34H28O21 |
| Molecular Weight | 772.58 g/mol |
| Exact Mass | 772.11 |
| IUPAC Name | [(2R,3S,4R,6R)-3,4,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OC(=O)c2cc(O)c(O)c(O)c2)C[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C34H28O21/c35-15-1-11(2-16(36)26(15)43)31(47)51-10-24-30(55-34(50)14-7-21(41)29(46)22(42)8-14)23(53-32(48)12-3-17(37)27(44)18(38)4-12)9-25(52-24)54-33(49)13-5-19(39)28(45)20(40)6-13/h1-8,23-25,30,35-46H,9-10H2/t23-,24-,25-,30+/m1/s1 |
| InChIKey | SEKWCJPNNBWVAZ-GBRARVNLSA-N |
| XLogP | 1.73 |
| TPSA | 357.19 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|