C76H52NaO46 — CID 175827657
CID 175827657 (PubChem CID 175827657) has the molecular formula C76H52NaO46 and a molecular weight of 1724.20 g/mol.
| Compound Name | CID 175827657 |
|---|---|
| PubChem CID | 175827657 |
| Molecular Formula | C76H52NaO46 |
| Molecular Weight | 1724.20 g/mol |
| Exact Mass | 1723.16 |
| IUPAC Name | — |
| SMILES | O=C(OC[C@H]1O[C@H](OC(=O)c2cc(O)c(O)c(OC(=O)c3cc(O)c(O)c(O)c3)c2)[C@H](OC(=O)c2cc(O)c(O)c(OC(=O)c3cc(O)c(O)c(O)c3)c2)[C@@H](OC(=O)c2cc(O)c(O)c(OC(=O)c3cc(O)c(O)c(O)c3)c2)[C@@H]1OC(=O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1.[Na] |
| InChI | InChI=1S/C76H52O46.Na/c77-32-1-22(2-33(78)53(32)92)67(103)113-47-16-27(11-42(87)58(47)97)66(102)112-21-52-63(119-72(108)28-12-43(88)59(98)48(17-28)114-68(104)23-3-34(79)54(93)35(80)4-23)64(120-73(109)29-13-44(89)60(99)49(18-29)115-69(105)24-5-36(81)55(94)37(82)6-24)65(121-74(110)30-14-45(90)61(100)50(19-30)116-70(106)25-7-38(83)56(95)39(84)8-25)76(118-52)122-75(111)31-15-46(91)62(101)51(20-31)117-71(107)26-9-40(85)57(96)41(86)10-26;/h1-20,52,63-65,76-101H,21H2;/t52-,63-,64+,65-,76-;/m1./s1 |
| InChIKey | VQJBTIQTVOZLSR-VHTHROQRSA-N |
| XLogP | 4.46 |
| TPSA | 777.98 Ų |
| H-Bond Donors | 25 |
| H-Bond Acceptors | 46 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 123 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1724.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 25 |
| H-Bond Acceptors ≤ 10 | 46 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|