C33H26O21 — CID 18709973
[3,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]oxolan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 18709973) has the molecular formula C33H26O21 and a molecular weight of 758.55 g/mol. Its IUPAC name is [3,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]oxolan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [3,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]oxolan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 18709973 |
| Molecular Formula | C33H26O21 |
| Molecular Weight | 758.55 g/mol |
| Exact Mass | 758.10 |
| IUPAC Name | [3,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]oxolan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OCC1OC(OC(=O)c2cc(O)c(O)c(O)c2)C(OC(=O)c2cc(O)c(O)c(O)c2)C1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C33H26O21/c34-14-1-10(2-15(35)23(14)42)29(46)50-9-22-27(52-30(47)11-3-16(36)24(43)17(37)4-11)28(53-31(48)12-5-18(38)25(44)19(39)6-12)33(51-22)54-32(49)13-7-20(40)26(45)21(41)8-13/h1-8,22,27-28,33-45H,9H2 |
| InChIKey | YNWYQVDWHWFZFM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 357.19 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|