C27H22O17 — CID 15593117
(3,4,5,13,14,20,21,22-octahydroxy-8,17-dioxo-9,16-dioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-11-yl) 3,4,5-trihydroxybenzoate (PubChem CID 15593117) has the molecular formula C27H22O17 and a molecular weight of 618.46 g/mol. Its IUPAC name is (3,4,5,13,14,20,21,22-octahydroxy-8,17-dioxo-9,16-dioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-11-yl) 3,4,5-trihydroxybenzoate.
| Compound Name | (3,4,5,13,14,20,21,22-octahydroxy-8,17-dioxo-9,16-dioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-11-yl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 15593117 |
| Molecular Formula | C27H22O17 |
| Molecular Weight | 618.46 g/mol |
| Exact Mass | 618.09 |
| IUPAC Name | (3,4,5,13,14,20,21,22-octahydroxy-8,17-dioxo-9,16-dioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-11-yl) 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC1CC(O)C(O)C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC12)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H22O17/c28-9-1-6(2-10(29)17(9)33)25(39)42-14-5-13(32)20(36)24-23(14)43-26(40)7-3-11(30)18(34)21(37)15(7)16-8(27(41)44-24)4-12(31)19(35)22(16)38/h1-4,13-14,20,23-24,28-38H,5H2 |
| InChIKey | FHYYLIKSGBSTCS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 301.43 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.46 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|