C27H22O18 — CID 162965278
[(1R,19S,21S,22R)-6,7,8,11,12,13,22-heptahydroxy-21-(hydroxymethyl)-3,16-dioxo-2,17,20-trioxatetracyclo[16.3.1.04,9.010,15]docosa-4,6,8,10,12,14-hexaen-19-yl] 3,4,5-trihydroxybenzoate (PubChem CID 162965278) has the molecular formula C27H22O18 and a molecular weight of 634.46 g/mol. Its IUPAC name is [(1R,19S,21S,22R)-6,7,8,11,12,13,22-heptahydroxy-21-(hydroxymethyl)-3,16-dioxo-2,17,20-trioxatetracyclo[16.3.1.04,9.010,15]docosa-4,6,8,10,12,14-hexaen-19-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(1R,19S,21S,22R)-6,7,8,11,12,13,22-heptahydroxy-21-(hydroxymethyl)-3,16-dioxo-2,17,20-trioxatetracyclo[16.3.1.04,9.010,15]docosa-4,6,8,10,12,14-hexaen-19-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162965278 |
| Molecular Formula | C27H22O18 |
| Molecular Weight | 634.46 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | [(1R,19S,21S,22R)-6,7,8,11,12,13,22-heptahydroxy-21-(hydroxymethyl)-3,16-dioxo-2,17,20-trioxatetracyclo[16.3.1.04,9.010,15]docosa-4,6,8,10,12,14-hexaen-19-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@@H]1O[C@@H](CO)[C@@H]2OC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC1[C@@H]2O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H22O18/c28-5-13-22-21(38)23(27(42-13)45-24(39)6-1-9(29)16(33)10(30)2-6)44-26(41)8-4-12(32)18(35)20(37)15(8)14-7(25(40)43-22)3-11(31)17(34)19(14)36/h1-4,13,21-23,27-38H,5H2/t13-,21+,22-,23?,27-/m0/s1 |
| InChIKey | NJXCTOMVEYVVGG-ZFZQJQFZSA-N |
| XLogP | -0.30 |
| TPSA | 310.66 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.46 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|