C13H16O9 — CID 56835101
[(2R,3R,4R,5S)-3,5-dihydroxy-2-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate (PubChem CID 56835101) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,5-dihydroxy-2-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3R,4R,5S)-3,5-dihydroxy-2-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 56835101 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [(2R,3R,4R,5S)-3,5-dihydroxy-2-(hydroxymethyl)oxan-4-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@H]1[C@H](O)[C@@H](CO)OC[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H16O9/c14-3-9-11(19)12(8(17)4-21-9)22-13(20)5-1-6(15)10(18)7(16)2-5/h1-2,8-9,11-12,14-19H,3-4H2/t8-,9+,11+,12+/m0/s1 |
| InChIKey | MSANRIKNONNWHX-LUTQBAROSA-N |
| XLogP | -1.56 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|