C21H20O14 — CID 78189359
3,5-dihydroxy-1,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid (PubChem CID 78189359) has the molecular formula C21H20O14 and a molecular weight of 496.38 g/mol. Its IUPAC name is 3,5-dihydroxy-1,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid.
| Compound Name | 3,5-dihydroxy-1,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 78189359 |
| Molecular Formula | C21H20O14 |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 3,5-dihydroxy-1,4-bis[(3,4,5-trihydroxybenzoyl)oxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(OC1C(O)CC(OC(=O)c2cc(O)c(O)c(O)c2)(C(=O)O)CC1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C21H20O14/c22-9-1-7(2-10(23)15(9)28)18(30)34-17-13(26)5-21(20(32)33,6-14(17)27)35-19(31)8-3-11(24)16(29)12(25)4-8/h1-4,13-14,17,22-29H,5-6H2,(H,32,33) |
| InChIKey | UTNZIIOILCFURH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 251.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|