C30H28O18 — CID 122211020
trans-(3R,5R)-3,5-bis[(3,4-dihydroxy-5-methoxybenzoyl)oxy]-1-hydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid (PubChem CID 122211020) has the molecular formula C30H28O18 and a molecular weight of 676.54 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[(3,4-dihydroxy-5-methoxybenzoyl)oxy]-1-hydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-3,5-bis[(3,4-dihydroxy-5-methoxybenzoyl)oxy]-1-hydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122211020 |
| Molecular Formula | C30H28O18 |
| Molecular Weight | 676.54 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[(3,4-dihydroxy-5-methoxybenzoyl)oxy]-1-hydroxy-4-(3,4,5-trihydroxybenzoyl)oxycyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C(=O)O[C@@H]2CC(O)(C(=O)O)C[C@@H](OC(=O)c3cc(O)c(O)c(OC)c3)C2OC(=O)c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C30H28O18/c1-44-18-7-12(5-16(33)23(18)36)26(38)46-20-9-30(43,29(41)42)10-21(47-27(39)13-6-17(34)24(37)19(8-13)45-2)25(20)48-28(40)11-3-14(31)22(35)15(32)4-11/h3-8,20-21,25,31-37,43H,9-10H2,1-2H3,(H,41,42)/t20-,21-,25?,30?/m1/s1 |
| InChIKey | IWFJLVIHYSLUDR-RCRDDINRSA-N |
| XLogP | 1.23 |
| TPSA | 296.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|