C25H26O13 — CID 163019757
(1S,3S,4R,5S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,3-dihydroxy-5-(4-hydroxy-3,5-dimethoxybenzoyl)oxycyclohexane-1-carboxylic acid (PubChem CID 163019757) has the molecular formula C25H26O13 and a molecular weight of 534.47 g/mol. Its IUPAC name is (1S,3S,4R,5S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,3-dihydroxy-5-(4-hydroxy-3,5-dimethoxybenzoyl)oxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3S,4R,5S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,3-dihydroxy-5-(4-hydroxy-3,5-dimethoxybenzoyl)oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163019757 |
| Molecular Formula | C25H26O13 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | (1S,3S,4R,5S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,3-dihydroxy-5-(4-hydroxy-3,5-dimethoxybenzoyl)oxycyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C(=O)O[C@H]2C[C@](O)(C(=O)O)C[C@H](O)[C@H]2OC(=O)C=Cc2ccc(O)c(O)c2)cc(OC)c1O |
| InChI | InChI=1S/C25H26O13/c1-35-17-8-13(9-18(36-2)21(17)30)23(31)37-19-11-25(34,24(32)33)10-16(28)22(19)38-20(29)6-4-12-3-5-14(26)15(27)7-12/h3-9,16,19,22,26-28,30,34H,10-11H2,1-2H3,(H,32,33)/t16-,19-,22+,25-/m0/s1 |
| InChIKey | PYGQEDZSTFIHHP-KEXPTWFBSA-N |
| XLogP | 0.94 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|